C13H7BrF2N2 — CID 107933239
4-(4-bromoanilino)-2,3-difluorobenzonitrile (PubChem CID 107933239) has the molecular formula C13H7BrF2N2 and a molecular weight of 309.11 g/mol. Its IUPAC name is 4-(4-bromoanilino)-2,3-difluorobenzonitrile.
| Compound Name | 4-(4-bromoanilino)-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 107933239 |
| Molecular Formula | C13H7BrF2N2 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | 4-(4-bromoanilino)-2,3-difluorobenzonitrile |
| SMILES | N#Cc1ccc(Nc2ccc(Br)cc2)c(F)c1F |
| InChI | InChI=1S/C13H7BrF2N2/c14-9-2-4-10(5-3-9)18-11-6-1-8(7-17)12(15)13(11)16/h1-6,18H |
| InChIKey | YBBJGROFQQYXOX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |