C14H8F4N2O — CID 107933329
4-[4-(difluoromethoxy)anilino]-2,3-difluorobenzonitrile (PubChem CID 107933329) has the molecular formula C14H8F4N2O and a molecular weight of 296.22 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)anilino]-2,3-difluorobenzonitrile.
| Compound Name | 4-[4-(difluoromethoxy)anilino]-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 107933329 |
| Molecular Formula | C14H8F4N2O |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-[4-(difluoromethoxy)anilino]-2,3-difluorobenzonitrile |
| SMILES | N#Cc1ccc(Nc2ccc(OC(F)F)cc2)c(F)c1F |
| InChI | InChI=1S/C14H8F4N2O/c15-12-8(7-19)1-6-11(13(12)16)20-9-2-4-10(5-3-9)21-14(17)18/h1-6,14,20H |
| InChIKey | BJXOACQOHFTUJV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |