C15H9F4N — CID 165437703
3-(4-fluoro-2-methylphenyl)-5-(trifluoromethyl)benzonitrile (PubChem CID 165437703) has the molecular formula C15H9F4N and a molecular weight of 279.24 g/mol. Its IUPAC name is 3-(4-fluoro-2-methylphenyl)-5-(trifluoromethyl)benzonitrile.
| Compound Name | 3-(4-fluoro-2-methylphenyl)-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 165437703 |
| Molecular Formula | C15H9F4N |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3-(4-fluoro-2-methylphenyl)-5-(trifluoromethyl)benzonitrile |
| SMILES | Cc1cc(F)ccc1-c1cc(C#N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9F4N/c1-9-4-13(16)2-3-14(9)11-5-10(8-20)6-12(7-11)15(17,18)19/h2-7H,1H3 |
| InChIKey | FYQIRZZJMYGZBT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |