C30H45NSi5 — CID 176915778
trimethyl-[2-[2,3,5,6-tetrakis(2-trimethylsilylethynyl)-4-pyridinyl]ethynyl]silane (PubChem CID 176915778) has the molecular formula C30H45NSi5 and a molecular weight of 560.13 g/mol. Its IUPAC name is trimethyl-[2-[2,3,5,6-tetrakis(2-trimethylsilylethynyl)-4-pyridinyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[2,3,5,6-tetrakis(2-trimethylsilylethynyl)-4-pyridinyl]ethynyl]silane |
|---|---|
| PubChem CID | 176915778 |
| Molecular Formula | C30H45NSi5 |
| Molecular Weight | 560.13 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | trimethyl-[2-[2,3,5,6-tetrakis(2-trimethylsilylethynyl)-4-pyridinyl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1nc(C#C[Si](C)(C)C)c(C#C[Si](C)(C)C)c(C#C[Si](C)(C)C)c1C#C[Si](C)(C)C |
| InChI | InChI=1S/C30H45NSi5/c1-32(2,3)21-16-26-27(17-22-33(4,5)6)29(19-24-35(10,11)12)31-30(20-25-36(13,14)15)28(26)18-23-34(7,8)9/h1-15H3 |
| InChIKey | RDGVYISZKFUGLF-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.13 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|