C32H34N2Si2 — CID 164999487
trimethyl-[2-[5,7,14,16-tetramethyl-13-(2-trimethylsilylethynyl)-3,12-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaen-4-yl]ethynyl]silane (PubChem CID 164999487) has the molecular formula C32H34N2Si2 and a molecular weight of 502.81 g/mol. Its IUPAC name is trimethyl-[2-[5,7,14,16-tetramethyl-13-(2-trimethylsilylethynyl)-3,12-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaen-4-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[5,7,14,16-tetramethyl-13-(2-trimethylsilylethynyl)-3,12-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaen-4-yl]ethynyl]silane |
|---|---|
| PubChem CID | 164999487 |
| Molecular Formula | C32H34N2Si2 |
| Molecular Weight | 502.81 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | trimethyl-[2-[5,7,14,16-tetramethyl-13-(2-trimethylsilylethynyl)-3,12-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1(19),2,4,6,8,10(20),11,13,15,17-decaen-4-yl]ethynyl]silane |
| SMILES | Cc1ccc2c3nc(C#C[Si](C)(C)C)c(C)c4c(C)ccc(c5nc(C#C[Si](C)(C)C)c(C)c1c25)c43 |
| InChI | InChI=1S/C32H34N2Si2/c1-19-11-13-23-29-27(19)21(3)25(15-17-35(5,6)7)33-31(29)24-14-12-20(2)28-22(4)26(16-18-36(8,9)10)34-32(23)30(24)28/h11-14H,1-10H3 |
| InChIKey | IAOKZNRUDIUJAC-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.81 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|