C17H16N2Si — CID 102575397
trimethyl-[2-(1,10-phenanthrolin-4-yl)ethynyl]silane (PubChem CID 102575397) has the molecular formula C17H16N2Si and a molecular weight of 276.41 g/mol. Its IUPAC name is trimethyl-[2-(1,10-phenanthrolin-4-yl)ethynyl]silane.
| Compound Name | trimethyl-[2-(1,10-phenanthrolin-4-yl)ethynyl]silane |
|---|---|
| PubChem CID | 102575397 |
| Molecular Formula | C17H16N2Si |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | trimethyl-[2-(1,10-phenanthrolin-4-yl)ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1ccnc2c1ccc1cccnc12 |
| InChI | InChI=1S/C17H16N2Si/c1-20(2,3)12-9-13-8-11-19-17-15(13)7-6-14-5-4-10-18-16(14)17/h4-8,10-11H,1-3H3 |
| InChIKey | NOHJWCLKUDGOEL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|