About N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium
N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium (PubChem CID 140567742) has the molecular formula C37H27N7Ru
and a molecular weight of 670.74 g/mol. Its IUPAC name is N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium.
Molecular Properties
| Compound Name | N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium |
| PubChem CID | 140567742 |
| Molecular Formula | C37H27N7Ru |
| Molecular Weight | 670.74 g/mol |
| Exact Mass | 671.14 |
| IUPAC Name | N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium |
| SMILES | CNc1ccnc2c1ccc1cccnc12.[Ru].c1cnc2c(c1)ccc1cccnc12.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C13H11N3.2C12H8N2.Ru/c1-14-11-6-8-16-13-10(11)5-4-9-3-2-7-15-12(9)13;2*1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h2-8H,1H3,(H,14,16);2*1-8H; |
| InChIKey | SWSHBBLIGWVTBR-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 670.74 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium?
The IUPAC name of N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium (CID 140567742) is N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium.
What is the SMILES notation for N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium?
The canonical SMILES for N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium is CNc1ccnc2c1ccc1cccnc12.[Ru].c1cnc2c(c1)ccc1cccnc12.c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium?
The InChIKey is SWSHBBLIGWVTBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3.2C12H8N2.Ru/c1-14-11-6-8-16-13-10(11)5-4-9-3-2-7-15-12(9)13;2*1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h2-8H,1H3,(H,14,16);2*1-8H;.
What are the key properties of N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium?
N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium has a molecular weight of 670.74 g/mol, XLogP of 8.39, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1,10-phenanthrolin-4-amine;bis(1,10-phenanthroline);ruthenium is sourced from PubChem (CID 140567742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).