About 1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea
1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea (PubChem CID 122223048) has the molecular formula C21H19N5S
and a molecular weight of 373.49 g/mol. Its IUPAC name is 1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea.
Molecular Properties
| Compound Name | 1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea |
| PubChem CID | 122223048 |
| Molecular Formula | C21H19N5S |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea |
| SMILES | S=C(NCCNc1ccnc2c1ccc1cccnc12)Nc1ccccc1 |
| InChI | InChI=1S/C21H19N5S/c27-21(26-16-6-2-1-3-7-16)25-14-13-22-18-10-12-24-20-17(18)9-8-15-5-4-11-23-19(15)20/h1-12H,13-14H2,(H,22,24)(H2,25,26,27) |
| InChIKey | XDYXVECJTFCVMS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea?
The IUPAC name of 1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea (CID 122223048) is 1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea.
What is the SMILES notation for 1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea?
The canonical SMILES for 1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea is S=C(NCCNc1ccnc2c1ccc1cccnc12)Nc1ccccc1.
What is the InChIKey of 1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea?
The InChIKey is XDYXVECJTFCVMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N5S/c27-21(26-16-6-2-1-3-7-16)25-14-13-22-18-10-12-24-20-17(18)9-8-15-5-4-11-23-19(15)20/h1-12H,13-14H2,(H,22,24)(H2,25,26,27).
What are the key properties of 1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea?
1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea has a molecular weight of 373.49 g/mol, XLogP of 4.18, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,10-phenanthrolin-4-ylamino)ethyl]-3-phenylthiourea is sourced from PubChem (CID 122223048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).