About dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum
dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum (PubChem CID 10896613) has the molecular formula C18H16N2O4Pt
and a molecular weight of 519.41 g/mol. Its IUPAC name is dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum.
Molecular Properties
| Compound Name | dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum |
| PubChem CID | 10896613 |
| Molecular Formula | C18H16N2O4Pt |
| Molecular Weight | 519.41 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum |
| SMILES | COC(=O)/C=C/C(=O)OC.[Pt].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C6H8O4.Pt/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;1-9-5(7)3-4-6(8)10-2;/h1-8H;3-4H,1-2H3;/b;4-3+; |
| InChIKey | KEEFSKITCZKOSX-ITDJAWRYSA-N |
| XLogP | 2.67 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 519.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum?
The IUPAC name of dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum (CID 10896613) is dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum.
What is the SMILES notation for dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum?
The canonical SMILES for dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum is COC(=O)/C=C/C(=O)OC.[Pt].c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum?
The InChIKey is KEEFSKITCZKOSX-ITDJAWRYSA-N. The full InChI is InChI=1S/C12H8N2.C6H8O4.Pt/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;1-9-5(7)3-4-6(8)10-2;/h1-8H;3-4H,1-2H3;/b;4-3+;.
What are the key properties of dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum?
dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum has a molecular weight of 519.41 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (E)-but-2-enedioate;1,10-phenanthroline;platinum is sourced from PubChem (CID 10896613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).