C13H17ISi — CID 141195498
2-(4-iodo-3,5-dimethylphenyl)ethynyl-trimethylsilane (PubChem CID 141195498) has the molecular formula C13H17ISi and a molecular weight of 328.27 g/mol. Its IUPAC name is 2-(4-iodo-3,5-dimethylphenyl)ethynyl-trimethylsilane.
| Compound Name | 2-(4-iodo-3,5-dimethylphenyl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 141195498 |
| Molecular Formula | C13H17ISi |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-(4-iodo-3,5-dimethylphenyl)ethynyl-trimethylsilane |
| SMILES | Cc1cc(C#C[Si](C)(C)C)cc(C)c1I |
| InChI | InChI=1S/C13H17ISi/c1-10-8-12(6-7-15(3,4)5)9-11(2)13(10)14/h8-9H,1-5H3 |
| InChIKey | OOAFRINAAAUEBN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|