C17H25ISi — CID 11617909
2-[4-iodo-3,5-di(propan-2-yl)phenyl]ethynyl-trimethylsilane (PubChem CID 11617909) has the molecular formula C17H25ISi and a molecular weight of 384.38 g/mol. Its IUPAC name is 2-[4-iodo-3,5-di(propan-2-yl)phenyl]ethynyl-trimethylsilane.
| Compound Name | 2-[4-iodo-3,5-di(propan-2-yl)phenyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11617909 |
| Molecular Formula | C17H25ISi |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-[4-iodo-3,5-di(propan-2-yl)phenyl]ethynyl-trimethylsilane |
| SMILES | CC(C)c1cc(C#C[Si](C)(C)C)cc(C(C)C)c1I |
| InChI | InChI=1S/C17H25ISi/c1-12(2)15-10-14(8-9-19(5,6)7)11-16(13(3)4)17(15)18/h10-13H,1-7H3 |
| InChIKey | GMCATOOHNZLMEZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|