C47H69ISi — CID 122390862
2-[4-iodo-3,5-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]ethynyl-tri(propan-2-yl)silane (PubChem CID 122390862) has the molecular formula C47H69ISi and a molecular weight of 789.06 g/mol. Its IUPAC name is 2-[4-iodo-3,5-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[4-iodo-3,5-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 122390862 |
| Molecular Formula | C47H69ISi |
| Molecular Weight | 789.06 g/mol |
| Exact Mass | 788.42 |
| IUPAC Name | 2-[4-iodo-3,5-bis[2,4,6-tri(propan-2-yl)phenyl]phenyl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)c1cc(C(C)C)c(-c2cc(C#C[Si](C(C)C)(C(C)C)C(C)C)cc(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c2I)c(C(C)C)c1 |
| InChI | InChI=1S/C47H69ISi/c1-27(2)37-23-39(29(5)6)45(40(24-37)30(7)8)43-21-36(19-20-49(33(13)14,34(15)16)35(17)18)22-44(47(43)48)46-41(31(9)10)25-38(28(3)4)26-42(46)32(11)12/h21-35H,1-18H3 |
| InChIKey | DWNVWEPKNNMCRN-UHFFFAOYSA-N |
| XLogP | 15.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.06 |
| LogP ≤ 5 | 15.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|