C23H34Si — CID 53259172
2-(3,5-diethyl-4-ethynylphenyl)ethynyl-tri(propan-2-yl)silane (PubChem CID 53259172) has the molecular formula C23H34Si and a molecular weight of 338.61 g/mol. Its IUPAC name is 2-(3,5-diethyl-4-ethynylphenyl)ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-(3,5-diethyl-4-ethynylphenyl)ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 53259172 |
| Molecular Formula | C23H34Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 2-(3,5-diethyl-4-ethynylphenyl)ethynyl-tri(propan-2-yl)silane |
| SMILES | C#Cc1c(CC)cc(C#C[Si](C(C)C)(C(C)C)C(C)C)cc1CC |
| InChI | InChI=1S/C23H34Si/c1-10-21-15-20(16-22(11-2)23(21)12-3)13-14-24(17(4)5,18(6)7)19(8)9/h3,15-19H,10-11H2,1-2,4-9H3 |
| InChIKey | ICVUQKKLBNLJHI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|