C36H50OS — CID 101134255
4-sulfanyl-3,5-bis[2,4,6-tri(propan-2-yl)phenyl]phenol (PubChem CID 101134255) has the molecular formula C36H50OS and a molecular weight of 530.86 g/mol. Its IUPAC name is 4-sulfanyl-3,5-bis[2,4,6-tri(propan-2-yl)phenyl]phenol.
| Compound Name | 4-sulfanyl-3,5-bis[2,4,6-tri(propan-2-yl)phenyl]phenol |
|---|---|
| PubChem CID | 101134255 |
| Molecular Formula | C36H50OS |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | 4-sulfanyl-3,5-bis[2,4,6-tri(propan-2-yl)phenyl]phenol |
| SMILES | CC(C)c1cc(C(C)C)c(-c2cc(O)cc(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c2S)c(C(C)C)c1 |
| InChI | InChI=1S/C36H50OS/c1-19(2)25-13-28(21(5)6)34(29(14-25)22(7)8)32-17-27(37)18-33(36(32)38)35-30(23(9)10)15-26(20(3)4)16-31(35)24(11)12/h13-24,37-38H,1-12H3 |
| InChIKey | FYXRDSSGGRLFLE-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|