About CID 162408879
CID 162408879 (PubChem CID 162408879) has the molecular formula C51H71ClGe
and a molecular weight of 792.19 g/mol.
Molecular Properties
| Compound Name | CID 162408879 |
| PubChem CID | 162408879 |
| Molecular Formula | C51H71ClGe |
| Molecular Weight | 792.19 g/mol |
| Exact Mass | 792.45 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(C(C)C)c(-c2cc(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c([Ge]Cl)c(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c2)c(C(C)C)c1 |
| InChI | InChI=1S/C51H71ClGe/c1-27(2)36-19-40(30(7)8)48(41(20-36)31(9)10)39-25-46(49-42(32(11)12)21-37(28(3)4)22-43(49)33(13)14)51(53-52)47(26-39)50-44(34(15)16)23-38(29(5)6)24-45(50)35(17)18/h19-35H,1-18H3 |
| InChIKey | RKHIZHZXHSJMPX-UHFFFAOYSA-N |
| XLogP | 16.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 792.19 |
| LogP ≤ 5 | 16.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 162408879 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162408879?
The IUPAC name of CID 162408879 (CID 162408879) is not available.
What is the SMILES notation for CID 162408879?
The canonical SMILES for CID 162408879 is CC(C)c1cc(C(C)C)c(-c2cc(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c([Ge]Cl)c(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c2)c(C(C)C)c1.
What is the InChIKey of CID 162408879?
The InChIKey is RKHIZHZXHSJMPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C51H71ClGe/c1-27(2)36-19-40(30(7)8)48(41(20-36)31(9)10)39-25-46(49-42(32(11)12)21-37(28(3)4)22-43(49)33(13)14)51(53-52)47(26-39)50-44(34(15)16)23-38(29(5)6)24-45(50)35(17)18/h19-35H,1-18H3.
What are the key properties of CID 162408879?
CID 162408879 has a molecular weight of 792.19 g/mol, XLogP of 16.28, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162408879 is sourced from PubChem (CID 162408879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).