C19H30Si3 — CID 139768506
trimethyl-[2-[2-trimethylsilyl-6-(2-trimethylsilylethynyl)phenyl]ethynyl]silane (PubChem CID 139768506) has the molecular formula C19H30Si3 and a molecular weight of 342.71 g/mol. Its IUPAC name is trimethyl-[2-[2-trimethylsilyl-6-(2-trimethylsilylethynyl)phenyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[2-trimethylsilyl-6-(2-trimethylsilylethynyl)phenyl]ethynyl]silane |
|---|---|
| PubChem CID | 139768506 |
| Molecular Formula | C19H30Si3 |
| Molecular Weight | 342.71 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | trimethyl-[2-[2-trimethylsilyl-6-(2-trimethylsilylethynyl)phenyl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1cccc([Si](C)(C)C)c1C#C[Si](C)(C)C |
| InChI | InChI=1S/C19H30Si3/c1-20(2,3)15-13-17-11-10-12-19(22(7,8)9)18(17)14-16-21(4,5)6/h10-12H,1-9H3 |
| InChIKey | PFZWCEFQHWXAKY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.71 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|