C14H20N2OSi — CID 170876009
3-amino-3-[2-(2-trimethylsilylethynyl)phenyl]propanamide (PubChem CID 170876009) has the molecular formula C14H20N2OSi and a molecular weight of 260.41 g/mol. Its IUPAC name is 3-amino-3-[2-(2-trimethylsilylethynyl)phenyl]propanamide.
| Compound Name | 3-amino-3-[2-(2-trimethylsilylethynyl)phenyl]propanamide |
|---|---|
| PubChem CID | 170876009 |
| Molecular Formula | C14H20N2OSi |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-amino-3-[2-(2-trimethylsilylethynyl)phenyl]propanamide |
| SMILES | C[Si](C)(C)C#Cc1ccccc1C(N)CC(N)=O |
| InChI | InChI=1S/C14H20N2OSi/c1-18(2,3)9-8-11-6-4-5-7-12(11)13(15)10-14(16)17/h4-7,13H,10,15H2,1-3H3,(H2,16,17) |
| InChIKey | NWXGRDCQWWCVHT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|