C25H20N2O4S — CID 166891932
4-[2-[2-[[3-(methylideneamino)-2-[(Z)-prop-1-enyl]phenyl]sulfonylamino]phenyl]ethynyl]benzoic acid (PubChem CID 166891932) has the molecular formula C25H20N2O4S and a molecular weight of 444.51 g/mol. Its IUPAC name is 4-[2-[2-[[3-(methylideneamino)-2-[(Z)-prop-1-enyl]phenyl]sulfonylamino]phenyl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[2-[[3-(methylideneamino)-2-[(Z)-prop-1-enyl]phenyl]sulfonylamino]phenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 166891932 |
| Molecular Formula | C25H20N2O4S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 4-[2-[2-[[3-(methylideneamino)-2-[(Z)-prop-1-enyl]phenyl]sulfonylamino]phenyl]ethynyl]benzoic acid |
| SMILES | C=Nc1cccc(S(=O)(=O)Nc2ccccc2C#Cc2ccc(C(=O)O)cc2)c1/C=C\C |
| InChI | InChI=1S/C25H20N2O4S/c1-3-7-21-23(26-2)10-6-11-24(21)32(30,31)27-22-9-5-4-8-19(22)15-12-18-13-16-20(17-14-18)25(28)29/h3-11,13-14,16-17,27H,2H2,1H3,(H,28,29)/b7-3- |
| InChIKey | BJNHJJKLVWBZPP-CLTKARDFSA-N |
| XLogP | 4.95 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|