C26H19NO5S — CID 150613535
4-[2-[2-[(4-methoxynaphthalen-2-yl)sulfonylamino]phenyl]ethynyl]benzoic acid (PubChem CID 150613535) has the molecular formula C26H19NO5S and a molecular weight of 457.51 g/mol. Its IUPAC name is 4-[2-[2-[(4-methoxynaphthalen-2-yl)sulfonylamino]phenyl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[2-[(4-methoxynaphthalen-2-yl)sulfonylamino]phenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 150613535 |
| Molecular Formula | C26H19NO5S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 4-[2-[2-[(4-methoxynaphthalen-2-yl)sulfonylamino]phenyl]ethynyl]benzoic acid |
| SMILES | COc1cc(S(=O)(=O)Nc2ccccc2C#Cc2ccc(C(=O)O)cc2)cc2ccccc12 |
| InChI | InChI=1S/C26H19NO5S/c1-32-25-17-22(16-21-7-2-4-8-23(21)25)33(30,31)27-24-9-5-3-6-19(24)13-10-18-11-14-20(15-12-18)26(28)29/h2-9,11-12,14-17,27H,1H3,(H,28,29) |
| InChIKey | IUKGWOWVOUDCGC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|