C50H30F2N2O7S2 — CID 154940963
[4-[2-[5-fluoro-2-(naphthalen-2-ylsulfonylamino)phenyl]ethynyl]benzoyl] 2-fluoro-4-[2-[2-(naphthalen-2-ylsulfonylamino)phenyl]ethynyl]benzoate (PubChem CID 154940963) has the molecular formula C50H30F2N2O7S2 and a molecular weight of 872.93 g/mol. Its IUPAC name is [4-[2-[5-fluoro-2-(naphthalen-2-ylsulfonylamino)phenyl]ethynyl]benzoyl] 2-fluoro-4-[2-[2-(naphthalen-2-ylsulfonylamino)phenyl]ethynyl]benzoate.
| Compound Name | [4-[2-[5-fluoro-2-(naphthalen-2-ylsulfonylamino)phenyl]ethynyl]benzoyl] 2-fluoro-4-[2-[2-(naphthalen-2-ylsulfonylamino)phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 154940963 |
| Molecular Formula | C50H30F2N2O7S2 |
| Molecular Weight | 872.93 g/mol |
| Exact Mass | 872.15 |
| IUPAC Name | [4-[2-[5-fluoro-2-(naphthalen-2-ylsulfonylamino)phenyl]ethynyl]benzoyl] 2-fluoro-4-[2-[2-(naphthalen-2-ylsulfonylamino)phenyl]ethynyl]benzoate |
| SMILES | O=C(OC(=O)c1ccc(C#Cc2ccccc2NS(=O)(=O)c2ccc3ccccc3c2)cc1F)c1ccc(C#Cc2cc(F)ccc2NS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C50H30F2N2O7S2/c51-42-24-28-48(54-63(59,60)44-26-23-36-8-2-4-11-40(36)32-44)41(30-42)21-15-33-13-19-38(20-14-33)49(55)61-50(56)45-27-17-34(29-46(45)52)16-18-37-9-5-6-12-47(37)53-62(57,58)43-25-22-35-7-1-3-10-39(35)31-43/h1-14,17,19-20,22-32,53-54H |
| InChIKey | PIUAHXINNMSTJL-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.93 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|