C52H40N2O8S2 — CID 154941038
[4-[2-[2-[(4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)sulfonylamino]phenyl]ethynyl]benzoyl] 2-methyl-4-[2-[2-(naphthalen-2-ylsulfonylamino)phenyl]ethynyl]benzoate (PubChem CID 154941038) has the molecular formula C52H40N2O8S2 and a molecular weight of 885.03 g/mol. Its IUPAC name is [4-[2-[2-[(4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)sulfonylamino]phenyl]ethynyl]benzoyl] 2-methyl-4-[2-[2-(naphthalen-2-ylsulfonylamino)phenyl]ethynyl]benzoate.
| Compound Name | [4-[2-[2-[(4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)sulfonylamino]phenyl]ethynyl]benzoyl] 2-methyl-4-[2-[2-(naphthalen-2-ylsulfonylamino)phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 154941038 |
| Molecular Formula | C52H40N2O8S2 |
| Molecular Weight | 885.03 g/mol |
| Exact Mass | 884.22 |
| IUPAC Name | [4-[2-[2-[(4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)sulfonylamino]phenyl]ethynyl]benzoyl] 2-methyl-4-[2-[2-(naphthalen-2-ylsulfonylamino)phenyl]ethynyl]benzoate |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2C#Cc2ccc(C(=O)OC(=O)c3ccc(C#Cc4ccccc4NS(=O)(=O)c4ccc5ccccc5c4)cc3C)cc2)c2c1CCCC2 |
| InChI | InChI=1S/C52H40N2O8S2/c1-35-33-37(22-25-40-13-5-9-17-47(40)53-63(57,58)43-29-28-38-11-3-4-14-42(38)34-43)23-30-44(35)52(56)62-51(55)41-26-20-36(21-27-41)19-24-39-12-6-10-18-48(39)54-64(59,60)50-32-31-49(61-2)45-15-7-8-16-46(45)50/h3-6,9-14,17-18,20-21,23,26-34,53-54H,7-8,15-16H2,1-2H3 |
| InChIKey | OKXNZPGBWLVRII-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.03 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|