C23H18O5S — CID 167349931
4-[2-[2-(4-methoxy-2-methylphenyl)sulfonylphenyl]ethynyl]benzoic acid (PubChem CID 167349931) has the molecular formula C23H18O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is 4-[2-[2-(4-methoxy-2-methylphenyl)sulfonylphenyl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[2-(4-methoxy-2-methylphenyl)sulfonylphenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 167349931 |
| Molecular Formula | C23H18O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 4-[2-[2-(4-methoxy-2-methylphenyl)sulfonylphenyl]ethynyl]benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)c2ccccc2C#Cc2ccc(C(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C23H18O5S/c1-16-15-20(28-2)13-14-21(16)29(26,27)22-6-4-3-5-18(22)10-7-17-8-11-19(12-9-17)23(24)25/h3-6,8-9,11-15H,1-2H3,(H,24,25) |
| InChIKey | AGWYIGUOKMXRRF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|