C29H26O7 — CID 171933786
methyl 4-[2-[5-[2-(3,4-dimethoxyphenyl)ethynyl]-2,4-dimethoxyphenyl]ethynyl]-2-methoxybenzoate (PubChem CID 171933786) has the molecular formula C29H26O7 and a molecular weight of 486.52 g/mol. Its IUPAC name is methyl 4-[2-[5-[2-(3,4-dimethoxyphenyl)ethynyl]-2,4-dimethoxyphenyl]ethynyl]-2-methoxybenzoate.
| Compound Name | methyl 4-[2-[5-[2-(3,4-dimethoxyphenyl)ethynyl]-2,4-dimethoxyphenyl]ethynyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 171933786 |
| Molecular Formula | C29H26O7 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | methyl 4-[2-[5-[2-(3,4-dimethoxyphenyl)ethynyl]-2,4-dimethoxyphenyl]ethynyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1ccc(C#Cc2cc(C#Cc3ccc(OC)c(OC)c3)c(OC)cc2OC)cc1OC |
| InChI | InChI=1S/C29H26O7/c1-31-24-14-10-20(16-28(24)35-5)8-12-22-17-21(25(32-2)18-26(22)33-3)11-7-19-9-13-23(29(30)36-6)27(15-19)34-4/h9-10,13-18H,1-6H3 |
| InChIKey | BWRRPMYTXZTTLZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|