C38H26O6 — CID 24776888
2-[4-[2-[2-[2-[4-(2-carboxyphenyl)phenyl]ethynyl]-4,5-dimethoxyphenyl]ethynyl]phenyl]benzoic acid (PubChem CID 24776888) has the molecular formula C38H26O6 and a molecular weight of 578.62 g/mol. Its IUPAC name is 2-[4-[2-[2-[2-[4-(2-carboxyphenyl)phenyl]ethynyl]-4,5-dimethoxyphenyl]ethynyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[2-[2-[2-[4-(2-carboxyphenyl)phenyl]ethynyl]-4,5-dimethoxyphenyl]ethynyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 24776888 |
| Molecular Formula | C38H26O6 |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | 2-[4-[2-[2-[2-[4-(2-carboxyphenyl)phenyl]ethynyl]-4,5-dimethoxyphenyl]ethynyl]phenyl]benzoic acid |
| SMILES | COc1cc(C#Cc2ccc(-c3ccccc3C(=O)O)cc2)c(C#Cc2ccc(-c3ccccc3C(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C38H26O6/c1-43-35-23-29(21-15-25-11-17-27(18-12-25)31-7-3-5-9-33(31)37(39)40)30(24-36(35)44-2)22-16-26-13-19-28(20-14-26)32-8-4-6-10-34(32)38(41)42/h3-14,17-20,23-24H,1-2H3,(H,39,40)(H,41,42) |
| InChIKey | UIEYBPCKVKAOBS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|