C52H26O8 — CID 90005585
4-[2-[3,6,8-tris[2-(4-carboxyphenyl)ethynyl]pyren-1-yl]ethynyl]benzoic acid (PubChem CID 90005585) has the molecular formula C52H26O8 and a molecular weight of 778.77 g/mol. Its IUPAC name is 4-[2-[3,6,8-tris[2-(4-carboxyphenyl)ethynyl]pyren-1-yl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[3,6,8-tris[2-(4-carboxyphenyl)ethynyl]pyren-1-yl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 90005585 |
| Molecular Formula | C52H26O8 |
| Molecular Weight | 778.77 g/mol |
| Exact Mass | 778.16 |
| IUPAC Name | 4-[2-[3,6,8-tris[2-(4-carboxyphenyl)ethynyl]pyren-1-yl]ethynyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C#Cc2cc(C#Cc3ccc(C(=O)O)cc3)c3ccc4c(C#Cc5ccc(C(=O)O)cc5)cc(C#Cc5ccc(C(=O)O)cc5)c5ccc2c3c54)cc1 |
| InChI | InChI=1S/C52H26O8/c53-49(54)35-13-1-31(2-14-35)9-21-39-29-40(22-10-32-3-15-36(16-4-32)50(55)56)44-27-28-46-42(24-12-34-7-19-38(20-8-34)52(59)60)30-41(45-26-25-43(39)47(44)48(45)46)23-11-33-5-17-37(18-6-33)51(57)58/h1-8,13-20,25-30H,(H,53,54)(H,55,56)(H,57,58)(H,59,60) |
| InChIKey | KKCMOJXVSJSNKW-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.77 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|