C25H15NO6 — CID 134960614
4-amino-3,5-bis[2-(4-carboxyphenyl)ethynyl]benzoic acid (PubChem CID 134960614) has the molecular formula C25H15NO6 and a molecular weight of 425.40 g/mol. Its IUPAC name is 4-amino-3,5-bis[2-(4-carboxyphenyl)ethynyl]benzoic acid.
| Compound Name | 4-amino-3,5-bis[2-(4-carboxyphenyl)ethynyl]benzoic acid |
|---|---|
| PubChem CID | 134960614 |
| Molecular Formula | C25H15NO6 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 4-amino-3,5-bis[2-(4-carboxyphenyl)ethynyl]benzoic acid |
| SMILES | Nc1c(C#Cc2ccc(C(=O)O)cc2)cc(C(=O)O)cc1C#Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H15NO6/c26-22-19(11-5-15-1-7-17(8-2-15)23(27)28)13-21(25(31)32)14-20(22)12-6-16-3-9-18(10-4-16)24(29)30/h1-4,7-10,13-14H,26H2,(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | CMHAVVXCFHBMSR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|