C27H21NO4 — CID 46835128
3-[2-[2-amino-3-[2-(3-carboxyphenyl)ethynyl]-5-propan-2-ylphenyl]ethynyl]benzoic acid (PubChem CID 46835128) has the molecular formula C27H21NO4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-[2-[2-amino-3-[2-(3-carboxyphenyl)ethynyl]-5-propan-2-ylphenyl]ethynyl]benzoic acid.
| Compound Name | 3-[2-[2-amino-3-[2-(3-carboxyphenyl)ethynyl]-5-propan-2-ylphenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 46835128 |
| Molecular Formula | C27H21NO4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 3-[2-[2-amino-3-[2-(3-carboxyphenyl)ethynyl]-5-propan-2-ylphenyl]ethynyl]benzoic acid |
| SMILES | CC(C)c1cc(C#Cc2cccc(C(=O)O)c2)c(N)c(C#Cc2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C27H21NO4/c1-17(2)24-15-20(11-9-18-5-3-7-22(13-18)26(29)30)25(28)21(16-24)12-10-19-6-4-8-23(14-19)27(31)32/h3-8,13-17H,28H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | GJQWCTGCRGULPM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|