C12H10O4 — CID 11031303
3-(4-carboxybut-1-ynyl)benzoic acid (PubChem CID 11031303) has the molecular formula C12H10O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is 3-(4-carboxybut-1-ynyl)benzoic acid.
| Compound Name | 3-(4-carboxybut-1-ynyl)benzoic acid |
|---|---|
| PubChem CID | 11031303 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 3-(4-carboxybut-1-ynyl)benzoic acid |
| SMILES | O=C(O)CCC#Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C12H10O4/c13-11(14)7-2-1-4-9-5-3-6-10(8-9)12(15)16/h3,5-6,8H,2,7H2,(H,13,14)(H,15,16) |
| InChIKey | DMFQPECKAUWLCE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|