C18H20FN3O2S — CID 17441393
(E)-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]prop-2-enamide (PubChem CID 17441393) has the molecular formula C18H20FN3O2S and a molecular weight of 361.44 g/mol. Its IUPAC name is (E)-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 17441393 |
| Molecular Formula | C18H20FN3O2S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (E)-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]prop-2-enamide |
| SMILES | CC(C)NC(=O)CN(C)C(=O)/C=C/c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H20FN3O2S/c1-12(2)20-16(23)10-22(3)17(24)9-8-15-11-25-18(21-15)13-4-6-14(19)7-5-13/h4-9,11-12H,10H2,1-3H3,(H,20,23)/b9-8+ |
| InChIKey | CWUBHLAJIGULJU-CMDGGOBGSA-N |
| XLogP | 2.95 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|