C20H16ClFN2OS — CID 17492499
(E)-N-[(3-chlorophenyl)methyl]-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-methylprop-2-enamide (PubChem CID 17492499) has the molecular formula C20H16ClFN2OS and a molecular weight of 386.88 g/mol. Its IUPAC name is (E)-N-[(3-chlorophenyl)methyl]-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-methylprop-2-enamide.
| Compound Name | (E)-N-[(3-chlorophenyl)methyl]-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 17492499 |
| Molecular Formula | C20H16ClFN2OS |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | (E)-N-[(3-chlorophenyl)methyl]-3-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-N-methylprop-2-enamide |
| SMILES | CN(Cc1cccc(Cl)c1)C(=O)/C=C/c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H16ClFN2OS/c1-24(12-14-3-2-4-16(21)11-14)19(25)10-9-18-13-26-20(23-18)15-5-7-17(22)8-6-15/h2-11,13H,12H2,1H3/b10-9+ |
| InChIKey | REOOOEPQGPWKGW-MDZDMXLPSA-N |
| XLogP | 5.27 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|