C14H12N2O3S2 — CID 32500964
N-[4-[2-(furan-2-yl)-1,3-thiazol-4-yl]phenyl]methanesulfonamide (PubChem CID 32500964) has the molecular formula C14H12N2O3S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is N-[4-[2-(furan-2-yl)-1,3-thiazol-4-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-(furan-2-yl)-1,3-thiazol-4-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 32500964 |
| Molecular Formula | C14H12N2O3S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | N-[4-[2-(furan-2-yl)-1,3-thiazol-4-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2csc(-c3ccco3)n2)cc1 |
| InChI | InChI=1S/C14H12N2O3S2/c1-21(17,18)16-11-6-4-10(5-7-11)12-9-20-14(15-12)13-3-2-8-19-13/h2-9,16H,1H3 |
| InChIKey | XIWGVFDWXOLIJO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |