C22H21FN2O3S — CID 7522136
(E)-3-(3,4-dimethoxyphenyl)-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]prop-2-enamide (PubChem CID 7522136) has the molecular formula C22H21FN2O3S and a molecular weight of 412.49 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 7522136 |
| Molecular Formula | C22H21FN2O3S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCc2csc(-c3ccc(F)cc3)n2)cc1OC |
| InChI | InChI=1S/C22H21FN2O3S/c1-27-19-9-3-15(13-20(19)28-2)4-10-21(26)24-12-11-18-14-29-22(25-18)16-5-7-17(23)8-6-16/h3-10,13-14H,11-12H2,1-2H3,(H,24,26)/b10-4+ |
| InChIKey | JZPUJSRCLLGNIN-ONNFQVAWSA-N |
| XLogP | 4.34 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|