C23H18F3NO5S — CID 134229858
[3-[(E)-3-amino-3-oxoprop-1-enyl]-4-(3-phenylmethoxyphenyl)phenyl] trifluoromethanesulfonate (PubChem CID 134229858) has the molecular formula C23H18F3NO5S and a molecular weight of 477.46 g/mol. Its IUPAC name is [3-[(E)-3-amino-3-oxoprop-1-enyl]-4-(3-phenylmethoxyphenyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3-[(E)-3-amino-3-oxoprop-1-enyl]-4-(3-phenylmethoxyphenyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134229858 |
| Molecular Formula | C23H18F3NO5S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | [3-[(E)-3-amino-3-oxoprop-1-enyl]-4-(3-phenylmethoxyphenyl)phenyl] trifluoromethanesulfonate |
| SMILES | NC(=O)/C=C/c1cc(OS(=O)(=O)C(F)(F)F)ccc1-c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H18F3NO5S/c24-23(25,26)33(29,30)32-20-10-11-21(18(14-20)9-12-22(27)28)17-7-4-8-19(13-17)31-15-16-5-2-1-3-6-16/h1-14H,15H2,(H2,27,28)/b12-9+ |
| InChIKey | WAWPVLFYNSGEFN-FMIVXFBMSA-N |
| XLogP | 4.66 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|