C17H11F3O6S — CID 88879453
(E)-3-[2-(3-formylphenyl)-5-(trifluoromethylsulfonyloxy)phenyl]prop-2-enoic acid (PubChem CID 88879453) has the molecular formula C17H11F3O6S and a molecular weight of 400.33 g/mol. Its IUPAC name is (E)-3-[2-(3-formylphenyl)-5-(trifluoromethylsulfonyloxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(3-formylphenyl)-5-(trifluoromethylsulfonyloxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 88879453 |
| Molecular Formula | C17H11F3O6S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | (E)-3-[2-(3-formylphenyl)-5-(trifluoromethylsulfonyloxy)phenyl]prop-2-enoic acid |
| SMILES | O=Cc1cccc(-c2ccc(OS(=O)(=O)C(F)(F)F)cc2/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C17H11F3O6S/c18-17(19,20)27(24,25)26-14-5-6-15(13(9-14)4-7-16(22)23)12-3-1-2-11(8-12)10-21/h1-10H,(H,22,23)/b7-4+ |
| InChIKey | MBDPRTGRZXXVFW-QPJJXVBHSA-N |
| XLogP | 3.49 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|