C19H15F3O6S — CID 173050791
2-[[2-(3-formylphenyl)-5-(trifluoromethylsulfonyloxy)phenyl]methylidene]butanoic acid (PubChem CID 173050791) has the molecular formula C19H15F3O6S and a molecular weight of 428.38 g/mol. Its IUPAC name is 2-[[2-(3-formylphenyl)-5-(trifluoromethylsulfonyloxy)phenyl]methylidene]butanoic acid.
| Compound Name | 2-[[2-(3-formylphenyl)-5-(trifluoromethylsulfonyloxy)phenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 173050791 |
| Molecular Formula | C19H15F3O6S |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 2-[[2-(3-formylphenyl)-5-(trifluoromethylsulfonyloxy)phenyl]methylidene]butanoic acid |
| SMILES | CCC(=Cc1cc(OS(=O)(=O)C(F)(F)F)ccc1-c1cccc(C=O)c1)C(=O)O |
| InChI | InChI=1S/C19H15F3O6S/c1-2-13(18(24)25)9-15-10-16(28-29(26,27)19(20,21)22)6-7-17(15)14-5-3-4-12(8-14)11-23/h3-11H,2H2,1H3,(H,24,25) |
| InChIKey | NCZOISFDDILBSH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|