C25H22O4 — CID 130342680
(E)-3-[2-[4-(3-ethylphenyl)-3-formylphenyl]-5-methoxyphenyl]prop-2-enoic acid (PubChem CID 130342680) has the molecular formula C25H22O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is (E)-3-[2-[4-(3-ethylphenyl)-3-formylphenyl]-5-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[4-(3-ethylphenyl)-3-formylphenyl]-5-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 130342680 |
| Molecular Formula | C25H22O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (E)-3-[2-[4-(3-ethylphenyl)-3-formylphenyl]-5-methoxyphenyl]prop-2-enoic acid |
| SMILES | CCc1cccc(-c2ccc(-c3ccc(OC)cc3/C=C/C(=O)O)cc2C=O)c1 |
| InChI | InChI=1S/C25H22O4/c1-3-17-5-4-6-18(13-17)24-10-7-19(14-21(24)16-26)23-11-9-22(29-2)15-20(23)8-12-25(27)28/h4-16H,3H2,1-2H3,(H,27,28)/b12-8+ |
| InChIKey | QRYXJHSSEHHTHT-XYOKQWHBSA-N |
| XLogP | 5.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|