C16H18N2O6 — CID 95982857
N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-2-(2,5-dioxopyrrolidin-1-yl)acetamide (PubChem CID 95982857) has the molecular formula C16H18N2O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-2-(2,5-dioxopyrrolidin-1-yl)acetamide.
| Compound Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-2-(2,5-dioxopyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 95982857 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-hydroxypropyl]-2-(2,5-dioxopyrrolidin-1-yl)acetamide |
| SMILES | C[C@@](O)(CNC(=O)CN1C(=O)CCC1=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H18N2O6/c1-16(22,10-2-3-11-12(6-10)24-9-23-11)8-17-13(19)7-18-14(20)4-5-15(18)21/h2-3,6,22H,4-5,7-9H2,1H3,(H,17,19)/t16-/m1/s1 |
| InChIKey | SYMZTBCWQJZVAS-MRXNPFEDSA-N |
| XLogP | -0.11 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|