C17H24IN3O3S — CID 111823888
2-[(3,4-dimethoxyphenyl)methyl]-1-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111823888) has the molecular formula C17H24IN3O3S and a molecular weight of 477.37 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111823888 |
| Molecular Formula | C17H24IN3O3S |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCC(C)(O)c2cccs2)cc1OC.I |
| InChI | InChI=1S/C17H23N3O3S.HI/c1-17(21,15-5-4-8-24-15)11-20-16(18)19-10-12-6-7-13(22-2)14(9-12)23-3;/h4-9,21H,10-11H2,1-3H3,(H3,18,19,20);1H |
| InChIKey | WYXRRRKDIHBSST-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|