C14H18N2O2S2 — CID 111440752
1-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(2-thiophen-2-ylethyl)urea (PubChem CID 111440752) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 111440752 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 1-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(2-thiophen-2-ylethyl)urea |
| SMILES | CC(O)(CNC(=O)NCCc1cccs1)c1cccs1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-14(18,12-5-3-9-20-12)10-16-13(17)15-7-6-11-4-2-8-19-11/h2-5,8-9,18H,6-7,10H2,1H3,(H2,15,16,17) |
| InChIKey | VCOAZSIXBKYQGC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |