C17H19N3O4S — CID 90499924
N'-(4-acetamidophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)oxamide (PubChem CID 90499924) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is N'-(4-acetamidophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)oxamide.
| Compound Name | N'-(4-acetamidophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)oxamide |
|---|---|
| PubChem CID | 90499924 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N'-(4-acetamidophenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)oxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(=O)NCC(C)(O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H19N3O4S/c1-11(21)19-12-5-7-13(8-6-12)20-16(23)15(22)18-10-17(2,24)14-4-3-9-25-14/h3-9,24H,10H2,1-2H3,(H,18,22)(H,19,21)(H,20,23) |
| InChIKey | IBXZELIIOZKDRL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|