C17H16N2O3S — CID 111444414
N'-(3-ethynylphenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)oxamide (PubChem CID 111444414) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is N'-(3-ethynylphenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)oxamide.
| Compound Name | N'-(3-ethynylphenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)oxamide |
|---|---|
| PubChem CID | 111444414 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N'-(3-ethynylphenyl)-N-(2-hydroxy-2-thiophen-2-ylpropyl)oxamide |
| SMILES | C#Cc1cccc(NC(=O)C(=O)NCC(C)(O)c2cccs2)c1 |
| InChI | InChI=1S/C17H16N2O3S/c1-3-12-6-4-7-13(10-12)19-16(21)15(20)18-11-17(2,22)14-8-5-9-23-14/h1,4-10,22H,11H2,2H3,(H,18,20)(H,19,21) |
| InChIKey | YYUQYMQOXFKICO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|