C14H14FNO3S — CID 111860656
5-fluoro-2-hydroxy-N-(2-hydroxy-2-thiophen-2-ylpropyl)benzamide (PubChem CID 111860656) has the molecular formula C14H14FNO3S and a molecular weight of 295.33 g/mol. Its IUPAC name is 5-fluoro-2-hydroxy-N-(2-hydroxy-2-thiophen-2-ylpropyl)benzamide.
| Compound Name | 5-fluoro-2-hydroxy-N-(2-hydroxy-2-thiophen-2-ylpropyl)benzamide |
|---|---|
| PubChem CID | 111860656 |
| Molecular Formula | C14H14FNO3S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 5-fluoro-2-hydroxy-N-(2-hydroxy-2-thiophen-2-ylpropyl)benzamide |
| SMILES | CC(O)(CNC(=O)c1cc(F)ccc1O)c1cccs1 |
| InChI | InChI=1S/C14H14FNO3S/c1-14(19,12-3-2-6-20-12)8-16-13(18)10-7-9(15)4-5-11(10)17/h2-7,17,19H,8H2,1H3,(H,16,18) |
| InChIKey | HUIREKSTMNZQHP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |