C16H15FN4OS — CID 95907391
1-(4-fluorophenyl)-N-[(2R)-2-thiophen-3-ylpropyl]triazole-4-carboxamide (PubChem CID 95907391) has the molecular formula C16H15FN4OS and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(2R)-2-thiophen-3-ylpropyl]triazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[(2R)-2-thiophen-3-ylpropyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 95907391 |
| Molecular Formula | C16H15FN4OS |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(2R)-2-thiophen-3-ylpropyl]triazole-4-carboxamide |
| SMILES | C[C@@H](CNC(=O)c1cn(-c2ccc(F)cc2)nn1)c1ccsc1 |
| InChI | InChI=1S/C16H15FN4OS/c1-11(12-6-7-23-10-12)8-18-16(22)15-9-21(20-19-15)14-4-2-13(17)3-5-14/h2-7,9-11H,8H2,1H3,(H,18,22)/t11-/m0/s1 |
| InChIKey | MPEOWWGSSXAWDT-NSHDSACASA-N |
| XLogP | 3.00 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |