C20H21F5N2O2 — CID 86953510
N-[(2-fluorophenyl)methyl]-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)anilino]propanamide (PubChem CID 86953510) has the molecular formula C20H21F5N2O2 and a molecular weight of 416.39 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)anilino]propanamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)anilino]propanamide |
|---|---|
| PubChem CID | 86953510 |
| Molecular Formula | C20H21F5N2O2 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2-[3-(2,2,3,3-tetrafluoropropoxymethyl)anilino]propanamide |
| SMILES | CC(Nc1cccc(COCC(F)(F)C(F)F)c1)C(=O)NCc1ccccc1F |
| InChI | InChI=1S/C20H21F5N2O2/c1-13(18(28)26-10-15-6-2-3-8-17(15)21)27-16-7-4-5-14(9-16)11-29-12-20(24,25)19(22)23/h2-9,13,19,27H,10-12H2,1H3,(H,26,28) |
| InChIKey | LRTDGERUGDZMCK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|