C12H15F3N2O2 — CID 110877911
2-[3-(hydroxymethyl)anilino]-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 110877911) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-[3-(hydroxymethyl)anilino]-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-[3-(hydroxymethyl)anilino]-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 110877911 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-[3-(hydroxymethyl)anilino]-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(Nc1cccc(CO)c1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2/c1-8(11(19)16-7-12(13,14)15)17-10-4-2-3-9(5-10)6-18/h2-5,8,17-18H,6-7H2,1H3,(H,16,19) |
| InChIKey | VPNKAHRPGSNGFT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |