C17H18F2N2O3 — CID 110878851
N-[4-(difluoromethoxy)phenyl]-2-[3-(hydroxymethyl)anilino]propanamide (PubChem CID 110878851) has the molecular formula C17H18F2N2O3 and a molecular weight of 336.34 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-[3-(hydroxymethyl)anilino]propanamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-[3-(hydroxymethyl)anilino]propanamide |
|---|---|
| PubChem CID | 110878851 |
| Molecular Formula | C17H18F2N2O3 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-[3-(hydroxymethyl)anilino]propanamide |
| SMILES | CC(Nc1cccc(CO)c1)C(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H18F2N2O3/c1-11(20-14-4-2-3-12(9-14)10-22)16(23)21-13-5-7-15(8-6-13)24-17(18)19/h2-9,11,17,20,22H,10H2,1H3,(H,21,23) |
| InChIKey | IUSKZUNSJKQBKU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |