C11H11BrF4N2O — CID 107599310
2-(2-bromo-6-fluoroanilino)-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 107599310) has the molecular formula C11H11BrF4N2O and a molecular weight of 343.12 g/mol. Its IUPAC name is 2-(2-bromo-6-fluoroanilino)-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-(2-bromo-6-fluoroanilino)-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 107599310 |
| Molecular Formula | C11H11BrF4N2O |
| Molecular Weight | 343.12 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 2-(2-bromo-6-fluoroanilino)-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(Nc1c(F)cccc1Br)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H11BrF4N2O/c1-6(10(19)17-5-11(14,15)16)18-9-7(12)3-2-4-8(9)13/h2-4,6,18H,5H2,1H3,(H,17,19) |
| InChIKey | BBVRDMVUACLFKL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.12 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |