C23H36N4O3 — CID 86883181
tert-butyl N-[1-[[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]cyclopentyl]carbamate (PubChem CID 86883181) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 86883181 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | tert-butyl N-[1-[[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]carbamoyl]cyclopentyl]carbamate |
| SMILES | Cc1cc(NC(=O)C2(NC(=O)OC(C)(C)C)CCCC2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C23H36N4O3/c1-17-16-18(8-9-19(17)27-14-12-26(5)13-15-27)24-20(28)23(10-6-7-11-23)25-21(29)30-22(2,3)4/h8-9,16H,6-7,10-15H2,1-5H3,(H,24,28)(H,25,29) |
| InChIKey | PTYNVEYKNJIQPV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|