C17H23N3O4 — CID 70294522
tert-butyl N-[1-(phenylcarbamoylcarbamoyl)cyclobutyl]carbamate (PubChem CID 70294522) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is tert-butyl N-[1-(phenylcarbamoylcarbamoyl)cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-(phenylcarbamoylcarbamoyl)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 70294522 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | tert-butyl N-[1-(phenylcarbamoylcarbamoyl)cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)NC(=O)Nc2ccccc2)CCC1 |
| InChI | InChI=1S/C17H23N3O4/c1-16(2,3)24-15(23)20-17(10-7-11-17)13(21)19-14(22)18-12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3,(H,20,23)(H2,18,19,21,22) |
| InChIKey | TVVDTZOXCYDPMS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |