C18H23BrN2O4 — CID 66620541
tert-butyl N-[1-[[2-(4-bromophenyl)-2-oxoethyl]carbamoyl]cyclobutyl]carbamate (PubChem CID 66620541) has the molecular formula C18H23BrN2O4 and a molecular weight of 411.30 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(4-bromophenyl)-2-oxoethyl]carbamoyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(4-bromophenyl)-2-oxoethyl]carbamoyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 66620541 |
| Molecular Formula | C18H23BrN2O4 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | tert-butyl N-[1-[[2-(4-bromophenyl)-2-oxoethyl]carbamoyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)NCC(=O)c2ccc(Br)cc2)CCC1 |
| InChI | InChI=1S/C18H23BrN2O4/c1-17(2,3)25-16(24)21-18(9-4-10-18)15(23)20-11-14(22)12-5-7-13(19)8-6-12/h5-8H,4,9-11H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | WFRVOAOQPQPFLV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |